C10H20N4O2S3 — CID 103365285
3-amino-N,N-dimethyl-5-(4-methylsulfanylbutylamino)-1,2-thiazole-4-sulfonamide (PubChem CID 103365285) has the molecular formula C10H20N4O2S3 and a molecular weight of 324.50 g/mol. Its IUPAC name is 3-amino-N,N-dimethyl-5-(4-methylsulfanylbutylamino)-1,2-thiazole-4-sulfonamide.
| Compound Name | 3-amino-N,N-dimethyl-5-(4-methylsulfanylbutylamino)-1,2-thiazole-4-sulfonamide |
|---|---|
| PubChem CID | 103365285 |
| Molecular Formula | C10H20N4O2S3 |
| Molecular Weight | 324.50 g/mol |
| Exact Mass | 324.07 |
| IUPAC Name | 3-amino-N,N-dimethyl-5-(4-methylsulfanylbutylamino)-1,2-thiazole-4-sulfonamide |
| SMILES | CSCCCCNc1snc(N)c1S(=O)(=O)N(C)C |
| InChI | InChI=1S/C10H20N4O2S3/c1-14(2)19(15,16)8-9(11)13-18-10(8)12-6-4-5-7-17-3/h12H,4-7H2,1-3H3,(H2,11,13) |
| InChIKey | IYOOXUHRMKIJMQ-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 88.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.50 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|