C12H20N4OS2 — CID 103384184
3-amino-N-cyclopropyl-5-(4-methylsulfanylbutylamino)-1,2-thiazole-4-carboxamide (PubChem CID 103384184) has the molecular formula C12H20N4OS2 and a molecular weight of 300.45 g/mol. Its IUPAC name is 3-amino-N-cyclopropyl-5-(4-methylsulfanylbutylamino)-1,2-thiazole-4-carboxamide.
| Compound Name | 3-amino-N-cyclopropyl-5-(4-methylsulfanylbutylamino)-1,2-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 103384184 |
| Molecular Formula | C12H20N4OS2 |
| Molecular Weight | 300.45 g/mol |
| Exact Mass | 300.11 |
| IUPAC Name | 3-amino-N-cyclopropyl-5-(4-methylsulfanylbutylamino)-1,2-thiazole-4-carboxamide |
| SMILES | CSCCCCNc1snc(N)c1C(=O)NC1CC1 |
| InChI | InChI=1S/C12H20N4OS2/c1-18-7-3-2-6-14-12-9(10(13)16-19-12)11(17)15-8-4-5-8/h8,14H,2-7H2,1H3,(H2,13,16)(H,15,17) |
| InChIKey | CNHZYMIPWJTKSV-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.45 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|