About 3-amino-N-cyclopropyl-5-[2-(triazol-1-yl)ethylamino]-1,2-thiazole-4-carboxamide
3-amino-N-cyclopropyl-5-[2-(triazol-1-yl)ethylamino]-1,2-thiazole-4-carboxamide (PubChem CID 103384003) has the molecular formula C11H15N7OS
and a molecular weight of 293.36 g/mol. Its IUPAC name is 3-amino-N-cyclopropyl-5-[2-(triazol-1-yl)ethylamino]-1,2-thiazole-4-carboxamide.
Molecular Properties
| Compound Name | 3-amino-N-cyclopropyl-5-[2-(triazol-1-yl)ethylamino]-1,2-thiazole-4-carboxamide |
| PubChem CID | 103384003 |
| Molecular Formula | C11H15N7OS |
| Molecular Weight | 293.36 g/mol |
| Exact Mass | 293.11 |
| IUPAC Name | 3-amino-N-cyclopropyl-5-[2-(triazol-1-yl)ethylamino]-1,2-thiazole-4-carboxamide |
| SMILES | Nc1nsc(NCCn2ccnn2)c1C(=O)NC1CC1 |
| InChI | InChI=1S/C11H15N7OS/c12-9-8(10(19)15-7-1-2-7)11(20-16-9)13-3-5-18-6-4-14-17-18/h4,6-7,13H,1-3,5H2,(H2,12,16)(H,15,19) |
| InChIKey | NTYCSSSKHOULBD-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 110.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.36 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 3-amino-N-cyclopropyl-5-[2-(triazol-1-yl)ethylamino]-1,2-thiazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-N-cyclopropyl-5-[2-(triazol-1-yl)ethylamino]-1,2-thiazole-4-carboxamide?
The IUPAC name of 3-amino-N-cyclopropyl-5-[2-(triazol-1-yl)ethylamino]-1,2-thiazole-4-carboxamide (CID 103384003) is 3-amino-N-cyclopropyl-5-[2-(triazol-1-yl)ethylamino]-1,2-thiazole-4-carboxamide.
What is the SMILES notation for 3-amino-N-cyclopropyl-5-[2-(triazol-1-yl)ethylamino]-1,2-thiazole-4-carboxamide?
The canonical SMILES for 3-amino-N-cyclopropyl-5-[2-(triazol-1-yl)ethylamino]-1,2-thiazole-4-carboxamide is Nc1nsc(NCCn2ccnn2)c1C(=O)NC1CC1.
What is the InChIKey of 3-amino-N-cyclopropyl-5-[2-(triazol-1-yl)ethylamino]-1,2-thiazole-4-carboxamide?
The InChIKey is NTYCSSSKHOULBD-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15N7OS/c12-9-8(10(19)15-7-1-2-7)11(20-16-9)13-3-5-18-6-4-14-17-18/h4,6-7,13H,1-3,5H2,(H2,12,16)(H,15,19).
What are the key properties of 3-amino-N-cyclopropyl-5-[2-(triazol-1-yl)ethylamino]-1,2-thiazole-4-carboxamide?
3-amino-N-cyclopropyl-5-[2-(triazol-1-yl)ethylamino]-1,2-thiazole-4-carboxamide has a molecular weight of 293.36 g/mol, XLogP of 0.32, 6 rotatable bonds, 3 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-N-cyclopropyl-5-[2-(triazol-1-yl)ethylamino]-1,2-thiazole-4-carboxamide is sourced from PubChem (CID 103384003), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).