About 4-methyl-5-N-[2-(triazol-1-yl)ethyl]-1,2-thiazole-3,5-diamine
4-methyl-5-N-[2-(triazol-1-yl)ethyl]-1,2-thiazole-3,5-diamine (PubChem CID 103365106) has the molecular formula C8H12N6S
and a molecular weight of 224.29 g/mol. Its IUPAC name is 4-methyl-5-N-[2-(triazol-1-yl)ethyl]-1,2-thiazole-3,5-diamine.
Molecular Properties
| Compound Name | 4-methyl-5-N-[2-(triazol-1-yl)ethyl]-1,2-thiazole-3,5-diamine |
| PubChem CID | 103365106 |
| Molecular Formula | C8H12N6S |
| Molecular Weight | 224.29 g/mol |
| Exact Mass | 224.08 |
| IUPAC Name | 4-methyl-5-N-[2-(triazol-1-yl)ethyl]-1,2-thiazole-3,5-diamine |
| SMILES | Cc1c(N)nsc1NCCn1ccnn1 |
| InChI | InChI=1S/C8H12N6S/c1-6-7(9)12-15-8(6)10-2-4-14-5-3-11-13-14/h3,5,10H,2,4H2,1H3,(H2,9,12) |
| InChIKey | VQWWSQBOIKQXFC-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 81.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.29 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 4-methyl-5-N-[2-(triazol-1-yl)ethyl]-1,2-thiazole-3,5-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-5-N-[2-(triazol-1-yl)ethyl]-1,2-thiazole-3,5-diamine?
The IUPAC name of 4-methyl-5-N-[2-(triazol-1-yl)ethyl]-1,2-thiazole-3,5-diamine (CID 103365106) is 4-methyl-5-N-[2-(triazol-1-yl)ethyl]-1,2-thiazole-3,5-diamine.
What is the SMILES notation for 4-methyl-5-N-[2-(triazol-1-yl)ethyl]-1,2-thiazole-3,5-diamine?
The canonical SMILES for 4-methyl-5-N-[2-(triazol-1-yl)ethyl]-1,2-thiazole-3,5-diamine is Cc1c(N)nsc1NCCn1ccnn1.
What is the InChIKey of 4-methyl-5-N-[2-(triazol-1-yl)ethyl]-1,2-thiazole-3,5-diamine?
The InChIKey is VQWWSQBOIKQXFC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N6S/c1-6-7(9)12-15-8(6)10-2-4-14-5-3-11-13-14/h3,5,10H,2,4H2,1H3,(H2,9,12).
What are the key properties of 4-methyl-5-N-[2-(triazol-1-yl)ethyl]-1,2-thiazole-3,5-diamine?
4-methyl-5-N-[2-(triazol-1-yl)ethyl]-1,2-thiazole-3,5-diamine has a molecular weight of 224.29 g/mol, XLogP of 0.74, 4 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-5-N-[2-(triazol-1-yl)ethyl]-1,2-thiazole-3,5-diamine is sourced from PubChem (CID 103365106), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).