C12H13N7 — CID 102987204
3-N-[2-(triazol-1-yl)ethyl]quinoxaline-2,3-diamine (PubChem CID 102987204) has the molecular formula C12H13N7 and a molecular weight of 255.29 g/mol. Its IUPAC name is 3-N-[2-(triazol-1-yl)ethyl]quinoxaline-2,3-diamine.
| Compound Name | 3-N-[2-(triazol-1-yl)ethyl]quinoxaline-2,3-diamine |
|---|---|
| PubChem CID | 102987204 |
| Molecular Formula | C12H13N7 |
| Molecular Weight | 255.29 g/mol |
| Exact Mass | 255.12 |
| IUPAC Name | 3-N-[2-(triazol-1-yl)ethyl]quinoxaline-2,3-diamine |
| SMILES | Nc1nc2ccccc2nc1NCCn1ccnn1 |
| InChI | InChI=1S/C12H13N7/c13-11-12(14-5-7-19-8-6-15-18-19)17-10-4-2-1-3-9(10)16-11/h1-4,6,8H,5,7H2,(H2,13,16)(H,14,17) |
| InChIKey | HGWVRKQBSODZLI-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 94.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.29 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |