C14H20N4 — CID 102987406
3-N-(3,3-dimethylbutyl)quinoxaline-2,3-diamine (PubChem CID 102987406) has the molecular formula C14H20N4 and a molecular weight of 244.34 g/mol. Its IUPAC name is 3-N-(3,3-dimethylbutyl)quinoxaline-2,3-diamine.
| Compound Name | 3-N-(3,3-dimethylbutyl)quinoxaline-2,3-diamine |
|---|---|
| PubChem CID | 102987406 |
| Molecular Formula | C14H20N4 |
| Molecular Weight | 244.34 g/mol |
| Exact Mass | 244.17 |
| IUPAC Name | 3-N-(3,3-dimethylbutyl)quinoxaline-2,3-diamine |
| SMILES | CC(C)(C)CCNc1nc2ccccc2nc1N |
| InChI | InChI=1S/C14H20N4/c1-14(2,3)8-9-16-13-12(15)17-10-6-4-5-7-11(10)18-13/h4-7H,8-9H2,1-3H3,(H2,15,17)(H,16,18) |
| InChIKey | DOUHUYFLLULDKV-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.34 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |