C13H13N5S — CID 102984316
3-N-[2-(1,3-thiazol-2-yl)ethyl]quinoxaline-2,3-diamine (PubChem CID 102984316) has the molecular formula C13H13N5S and a molecular weight of 271.35 g/mol. Its IUPAC name is 3-N-[2-(1,3-thiazol-2-yl)ethyl]quinoxaline-2,3-diamine.
| Compound Name | 3-N-[2-(1,3-thiazol-2-yl)ethyl]quinoxaline-2,3-diamine |
|---|---|
| PubChem CID | 102984316 |
| Molecular Formula | C13H13N5S |
| Molecular Weight | 271.35 g/mol |
| Exact Mass | 271.09 |
| IUPAC Name | 3-N-[2-(1,3-thiazol-2-yl)ethyl]quinoxaline-2,3-diamine |
| SMILES | Nc1nc2ccccc2nc1NCCc1nccs1 |
| InChI | InChI=1S/C13H13N5S/c14-12-13(16-6-5-11-15-7-8-19-11)18-10-4-2-1-3-9(10)17-12/h1-4,7-8H,5-6H2,(H2,14,17)(H,16,18) |
| InChIKey | AUOCGZYILGKLRY-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 76.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.35 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |