C13H12N4S — CID 49432129
N-[2-(1,3-thiazol-2-yl)ethyl]quinoxalin-2-amine (PubChem CID 49432129) has the molecular formula C13H12N4S and a molecular weight of 256.33 g/mol. Its IUPAC name is N-[2-(1,3-thiazol-2-yl)ethyl]quinoxalin-2-amine.
| Compound Name | N-[2-(1,3-thiazol-2-yl)ethyl]quinoxalin-2-amine |
|---|---|
| PubChem CID | 49432129 |
| Molecular Formula | C13H12N4S |
| Molecular Weight | 256.33 g/mol |
| Exact Mass | 256.08 |
| IUPAC Name | N-[2-(1,3-thiazol-2-yl)ethyl]quinoxalin-2-amine |
| SMILES | c1ccc2nc(NCCc3nccs3)cnc2c1 |
| InChI | InChI=1S/C13H12N4S/c1-2-4-11-10(3-1)16-9-12(17-11)14-6-5-13-15-7-8-18-13/h1-4,7-9H,5-6H2,(H,14,17) |
| InChIKey | WOSWVABSVQJKRY-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.33 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |