C15H15N5 — CID 33372985
N-pyridin-2-yl-N'-quinoxalin-2-ylethane-1,2-diamine (PubChem CID 33372985) has the molecular formula C15H15N5 and a molecular weight of 265.32 g/mol. Its IUPAC name is N-pyridin-2-yl-N'-quinoxalin-2-ylethane-1,2-diamine.
| Compound Name | N-pyridin-2-yl-N'-quinoxalin-2-ylethane-1,2-diamine |
|---|---|
| PubChem CID | 33372985 |
| Molecular Formula | C15H15N5 |
| Molecular Weight | 265.32 g/mol |
| Exact Mass | 265.13 |
| IUPAC Name | N-pyridin-2-yl-N'-quinoxalin-2-ylethane-1,2-diamine |
| SMILES | c1ccc(NCCNc2cnc3ccccc3n2)nc1 |
| InChI | InChI=1S/C15H15N5/c1-2-6-13-12(5-1)19-11-15(20-13)18-10-9-17-14-7-3-4-8-16-14/h1-8,11H,9-10H2,(H,16,17)(H,18,20) |
| InChIKey | HLLUURKBWQYOBD-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 62.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.32 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|