About N-pyridin-2-yl-N'-quinoxalin-2-ylethane-1,2-diamine
N-pyridin-2-yl-N'-quinoxalin-2-ylethane-1,2-diamine (PubChem CID 33372985) has the molecular formula C15H15N5
and a molecular weight of 265.32 g/mol. Its IUPAC name is N-pyridin-2-yl-N'-quinoxalin-2-ylethane-1,2-diamine.
Molecular Properties
| Compound Name | N-pyridin-2-yl-N'-quinoxalin-2-ylethane-1,2-diamine |
| PubChem CID | 33372985 |
| Molecular Formula | C15H15N5 |
| Molecular Weight | 265.32 g/mol |
| Exact Mass | 265.13 |
| IUPAC Name | N-pyridin-2-yl-N'-quinoxalin-2-ylethane-1,2-diamine |
| SMILES | c1ccc(NCCNc2cnc3ccccc3n2)nc1 |
| InChI | InChI=1S/C15H15N5/c1-2-6-13-12(5-1)19-11-15(20-13)18-10-9-17-14-7-3-4-8-16-14/h1-8,11H,9-10H2,(H,16,17)(H,18,20) |
| InChIKey | HLLUURKBWQYOBD-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 62.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.32 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-pyridin-2-yl-N'-quinoxalin-2-ylethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-pyridin-2-yl-N'-quinoxalin-2-ylethane-1,2-diamine?
The IUPAC name of N-pyridin-2-yl-N'-quinoxalin-2-ylethane-1,2-diamine (CID 33372985) is N-pyridin-2-yl-N'-quinoxalin-2-ylethane-1,2-diamine.
What is the SMILES notation for N-pyridin-2-yl-N'-quinoxalin-2-ylethane-1,2-diamine?
The canonical SMILES for N-pyridin-2-yl-N'-quinoxalin-2-ylethane-1,2-diamine is c1ccc(NCCNc2cnc3ccccc3n2)nc1.
What is the InChIKey of N-pyridin-2-yl-N'-quinoxalin-2-ylethane-1,2-diamine?
The InChIKey is HLLUURKBWQYOBD-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15N5/c1-2-6-13-12(5-1)19-11-15(20-13)18-10-9-17-14-7-3-4-8-16-14/h1-8,11H,9-10H2,(H,16,17)(H,18,20).
What are the key properties of N-pyridin-2-yl-N'-quinoxalin-2-ylethane-1,2-diamine?
N-pyridin-2-yl-N'-quinoxalin-2-ylethane-1,2-diamine has a molecular weight of 265.32 g/mol, XLogP of 2.55, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-pyridin-2-yl-N'-quinoxalin-2-ylethane-1,2-diamine is sourced from PubChem (CID 33372985), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).