C14H21N5 — CID 102983578
3-N-[2-(diethylamino)ethyl]quinoxaline-2,3-diamine (PubChem CID 102983578) has the molecular formula C14H21N5 and a molecular weight of 259.36 g/mol. Its IUPAC name is 3-N-[2-(diethylamino)ethyl]quinoxaline-2,3-diamine.
| Compound Name | 3-N-[2-(diethylamino)ethyl]quinoxaline-2,3-diamine |
|---|---|
| PubChem CID | 102983578 |
| Molecular Formula | C14H21N5 |
| Molecular Weight | 259.36 g/mol |
| Exact Mass | 259.18 |
| IUPAC Name | 3-N-[2-(diethylamino)ethyl]quinoxaline-2,3-diamine |
| SMILES | CCN(CC)CCNc1nc2ccccc2nc1N |
| InChI | InChI=1S/C14H21N5/c1-3-19(4-2)10-9-16-14-13(15)17-11-7-5-6-8-12(11)18-14/h5-8H,3-4,9-10H2,1-2H3,(H2,15,17)(H,16,18) |
| InChIKey | LJWBUWKMHHDRTC-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 67.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.36 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |