C11H11N5S — CID 113375085
N-[2-(triazol-1-yl)ethyl]-2,1-benzothiazol-3-amine (PubChem CID 113375085) has the molecular formula C11H11N5S and a molecular weight of 245.31 g/mol. Its IUPAC name is N-[2-(triazol-1-yl)ethyl]-2,1-benzothiazol-3-amine.
| Compound Name | N-[2-(triazol-1-yl)ethyl]-2,1-benzothiazol-3-amine |
|---|---|
| PubChem CID | 113375085 |
| Molecular Formula | C11H11N5S |
| Molecular Weight | 245.31 g/mol |
| Exact Mass | 245.07 |
| IUPAC Name | N-[2-(triazol-1-yl)ethyl]-2,1-benzothiazol-3-amine |
| SMILES | c1ccc2c(NCCn3ccnn3)snc2c1 |
| InChI | InChI=1S/C11H11N5S/c1-2-4-10-9(3-1)11(17-14-10)12-5-7-16-8-6-13-15-16/h1-4,6,8,12H,5,7H2 |
| InChIKey | YZCSIEHWNKLLDS-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.31 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |