C12H17N5 — CID 113412414
2-methyl-3-N-[3-(triazol-1-yl)propyl]benzene-1,3-diamine (PubChem CID 113412414) has the molecular formula C12H17N5 and a molecular weight of 231.30 g/mol. Its IUPAC name is 2-methyl-3-N-[3-(triazol-1-yl)propyl]benzene-1,3-diamine.
| Compound Name | 2-methyl-3-N-[3-(triazol-1-yl)propyl]benzene-1,3-diamine |
|---|---|
| PubChem CID | 113412414 |
| Molecular Formula | C12H17N5 |
| Molecular Weight | 231.30 g/mol |
| Exact Mass | 231.15 |
| IUPAC Name | 2-methyl-3-N-[3-(triazol-1-yl)propyl]benzene-1,3-diamine |
| SMILES | Cc1c(N)cccc1NCCCn1ccnn1 |
| InChI | InChI=1S/C12H17N5/c1-10-11(13)4-2-5-12(10)14-6-3-8-17-9-7-15-16-17/h2,4-5,7,9,14H,3,6,8,13H2,1H3 |
| InChIKey | CCAWSDMNCQTZAN-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.30 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|