C10H15N7O — CID 113412429
6-methoxy-4-N-[3-(triazol-1-yl)propyl]pyrimidine-4,5-diamine (PubChem CID 113412429) has the molecular formula C10H15N7O and a molecular weight of 249.28 g/mol. Its IUPAC name is 6-methoxy-4-N-[3-(triazol-1-yl)propyl]pyrimidine-4,5-diamine.
| Compound Name | 6-methoxy-4-N-[3-(triazol-1-yl)propyl]pyrimidine-4,5-diamine |
|---|---|
| PubChem CID | 113412429 |
| Molecular Formula | C10H15N7O |
| Molecular Weight | 249.28 g/mol |
| Exact Mass | 249.13 |
| IUPAC Name | 6-methoxy-4-N-[3-(triazol-1-yl)propyl]pyrimidine-4,5-diamine |
| SMILES | COc1ncnc(NCCCn2ccnn2)c1N |
| InChI | InChI=1S/C10H15N7O/c1-18-10-8(11)9(13-7-14-10)12-3-2-5-17-6-4-15-16-17/h4,6-7H,2-3,5,11H2,1H3,(H,12,13,14) |
| InChIKey | RRLYFGNHFKTCON-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 103.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.28 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|