C9H14N4O — CID 114615244
6-methoxy-4-N-(2-methylprop-2-enyl)pyrimidine-4,5-diamine (PubChem CID 114615244) has the molecular formula C9H14N4O and a molecular weight of 194.24 g/mol. Its IUPAC name is 6-methoxy-4-N-(2-methylprop-2-enyl)pyrimidine-4,5-diamine.
| Compound Name | 6-methoxy-4-N-(2-methylprop-2-enyl)pyrimidine-4,5-diamine |
|---|---|
| PubChem CID | 114615244 |
| Molecular Formula | C9H14N4O |
| Molecular Weight | 194.24 g/mol |
| Exact Mass | 194.12 |
| IUPAC Name | 6-methoxy-4-N-(2-methylprop-2-enyl)pyrimidine-4,5-diamine |
| SMILES | C=C(C)CNc1ncnc(OC)c1N |
| InChI | InChI=1S/C9H14N4O/c1-6(2)4-11-8-7(10)9(14-3)13-5-12-8/h5H,1,4,10H2,2-3H3,(H,11,12,13) |
| InChIKey | UJSWUBJKFMJYRO-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.24 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|