C10H16N4O — CID 106182340
6-methoxy-4-N-(3-methylbut-2-enyl)pyrimidine-4,5-diamine (PubChem CID 106182340) has the molecular formula C10H16N4O and a molecular weight of 208.26 g/mol. Its IUPAC name is 6-methoxy-4-N-(3-methylbut-2-enyl)pyrimidine-4,5-diamine.
| Compound Name | 6-methoxy-4-N-(3-methylbut-2-enyl)pyrimidine-4,5-diamine |
|---|---|
| PubChem CID | 106182340 |
| Molecular Formula | C10H16N4O |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.13 |
| IUPAC Name | 6-methoxy-4-N-(3-methylbut-2-enyl)pyrimidine-4,5-diamine |
| SMILES | COc1ncnc(NCC=C(C)C)c1N |
| InChI | InChI=1S/C10H16N4O/c1-7(2)4-5-12-9-8(11)10(15-3)14-6-13-9/h4,6H,5,11H2,1-3H3,(H,12,13,14) |
| InChIKey | DOLRFTDBNKFQQO-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|