C13H19N3 — CID 103525255
N-(3-methylbut-2-enyl)-5,6,7,8-tetrahydroquinazolin-4-amine (PubChem CID 103525255) has the molecular formula C13H19N3 and a molecular weight of 217.32 g/mol. Its IUPAC name is N-(3-methylbut-2-enyl)-5,6,7,8-tetrahydroquinazolin-4-amine.
| Compound Name | N-(3-methylbut-2-enyl)-5,6,7,8-tetrahydroquinazolin-4-amine |
|---|---|
| PubChem CID | 103525255 |
| Molecular Formula | C13H19N3 |
| Molecular Weight | 217.32 g/mol |
| Exact Mass | 217.16 |
| IUPAC Name | N-(3-methylbut-2-enyl)-5,6,7,8-tetrahydroquinazolin-4-amine |
| SMILES | CC(C)=CCNc1ncnc2c1CCCC2 |
| InChI | InChI=1S/C13H19N3/c1-10(2)7-8-14-13-11-5-3-4-6-12(11)15-9-16-13/h7,9H,3-6,8H2,1-2H3,(H,14,15,16) |
| InChIKey | MQGPYQKCPBCPNT-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.32 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|