C13H20N4 — CID 113414897
(E)-N'-(6,7,8,9-tetrahydro-5H-cyclohepta[d]pyrimidin-4-yl)but-2-ene-1,4-diamine (PubChem CID 113414897) has the molecular formula C13H20N4 and a molecular weight of 232.33 g/mol. Its IUPAC name is (E)-N'-(6,7,8,9-tetrahydro-5H-cyclohepta[d]pyrimidin-4-yl)but-2-ene-1,4-diamine.
| Compound Name | (E)-N'-(6,7,8,9-tetrahydro-5H-cyclohepta[d]pyrimidin-4-yl)but-2-ene-1,4-diamine |
|---|---|
| PubChem CID | 113414897 |
| Molecular Formula | C13H20N4 |
| Molecular Weight | 232.33 g/mol |
| Exact Mass | 232.17 |
| IUPAC Name | (E)-N'-(6,7,8,9-tetrahydro-5H-cyclohepta[d]pyrimidin-4-yl)but-2-ene-1,4-diamine |
| SMILES | NC/C=C/CNc1ncnc2c1CCCCC2 |
| InChI | InChI=1S/C13H20N4/c14-8-4-5-9-15-13-11-6-2-1-3-7-12(11)16-10-17-13/h4-5,10H,1-3,6-9,14H2,(H,15,16,17)/b5-4+ |
| InChIKey | PDDOLWNLZVZDST-SNAWJCMRSA-N |
| XLogP | 1.67 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.33 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|