C10H15N7S — CID 113413349
2-methylsulfanyl-4-N-[3-(triazol-1-yl)propyl]pyrimidine-4,6-diamine (PubChem CID 113413349) has the molecular formula C10H15N7S and a molecular weight of 265.35 g/mol. Its IUPAC name is 2-methylsulfanyl-4-N-[3-(triazol-1-yl)propyl]pyrimidine-4,6-diamine.
| Compound Name | 2-methylsulfanyl-4-N-[3-(triazol-1-yl)propyl]pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 113413349 |
| Molecular Formula | C10H15N7S |
| Molecular Weight | 265.35 g/mol |
| Exact Mass | 265.11 |
| IUPAC Name | 2-methylsulfanyl-4-N-[3-(triazol-1-yl)propyl]pyrimidine-4,6-diamine |
| SMILES | CSc1nc(N)cc(NCCCn2ccnn2)n1 |
| InChI | InChI=1S/C10H15N7S/c1-18-10-14-8(11)7-9(15-10)12-3-2-5-17-6-4-13-16-17/h4,6-7H,2-3,5H2,1H3,(H3,11,12,14,15) |
| InChIKey | CGOPNUHACRWLSS-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 94.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.35 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|