C13H15N7O — CID 136824779
6-amino-7-[3-(triazol-1-yl)propylamino]-3H-quinazolin-4-one (PubChem CID 136824779) has the molecular formula C13H15N7O and a molecular weight of 285.31 g/mol. Its IUPAC name is 6-amino-7-[3-(triazol-1-yl)propylamino]-3H-quinazolin-4-one.
| Compound Name | 6-amino-7-[3-(triazol-1-yl)propylamino]-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 136824779 |
| Molecular Formula | C13H15N7O |
| Molecular Weight | 285.31 g/mol |
| Exact Mass | 285.13 |
| IUPAC Name | 6-amino-7-[3-(triazol-1-yl)propylamino]-3H-quinazolin-4-one |
| SMILES | Nc1cc2c(=O)[nH]cnc2cc1NCCCn1ccnn1 |
| InChI | InChI=1S/C13H15N7O/c14-10-6-9-11(16-8-17-13(9)21)7-12(10)15-2-1-4-20-5-3-18-19-20/h3,5-8,15H,1-2,4,14H2,(H,16,17,21) |
| InChIKey | ITUXCDAHHBATFE-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 114.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.31 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|