About 3-amino-N,N-dimethyl-5-(6-methylheptan-2-ylamino)-1,2-thiazole-4-sulfonamide
3-amino-N,N-dimethyl-5-(6-methylheptan-2-ylamino)-1,2-thiazole-4-sulfonamide (PubChem CID 103359978) has the molecular formula C13H26N4O2S2
and a molecular weight of 334.51 g/mol. Its IUPAC name is 3-amino-N,N-dimethyl-5-(6-methylheptan-2-ylamino)-1,2-thiazole-4-sulfonamide.
Molecular Properties
| Compound Name | 3-amino-N,N-dimethyl-5-(6-methylheptan-2-ylamino)-1,2-thiazole-4-sulfonamide |
| PubChem CID | 103359978 |
| Molecular Formula | C13H26N4O2S2 |
| Molecular Weight | 334.51 g/mol |
| Exact Mass | 334.15 |
| IUPAC Name | 3-amino-N,N-dimethyl-5-(6-methylheptan-2-ylamino)-1,2-thiazole-4-sulfonamide |
| SMILES | CC(C)CCCC(C)Nc1snc(N)c1S(=O)(=O)N(C)C |
| InChI | InChI=1S/C13H26N4O2S2/c1-9(2)7-6-8-10(3)15-13-11(12(14)16-20-13)21(18,19)17(4)5/h9-10,15H,6-8H2,1-5H3,(H2,14,16) |
| InChIKey | YYKWWJGRVFXMGQ-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 88.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.51 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-amino-N,N-dimethyl-5-(6-methylheptan-2-ylamino)-1,2-thiazole-4-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-N,N-dimethyl-5-(6-methylheptan-2-ylamino)-1,2-thiazole-4-sulfonamide?
The IUPAC name of 3-amino-N,N-dimethyl-5-(6-methylheptan-2-ylamino)-1,2-thiazole-4-sulfonamide (CID 103359978) is 3-amino-N,N-dimethyl-5-(6-methylheptan-2-ylamino)-1,2-thiazole-4-sulfonamide.
What is the SMILES notation for 3-amino-N,N-dimethyl-5-(6-methylheptan-2-ylamino)-1,2-thiazole-4-sulfonamide?
The canonical SMILES for 3-amino-N,N-dimethyl-5-(6-methylheptan-2-ylamino)-1,2-thiazole-4-sulfonamide is CC(C)CCCC(C)Nc1snc(N)c1S(=O)(=O)N(C)C.
What is the InChIKey of 3-amino-N,N-dimethyl-5-(6-methylheptan-2-ylamino)-1,2-thiazole-4-sulfonamide?
The InChIKey is YYKWWJGRVFXMGQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H26N4O2S2/c1-9(2)7-6-8-10(3)15-13-11(12(14)16-20-13)21(18,19)17(4)5/h9-10,15H,6-8H2,1-5H3,(H2,14,16).
What are the key properties of 3-amino-N,N-dimethyl-5-(6-methylheptan-2-ylamino)-1,2-thiazole-4-sulfonamide?
3-amino-N,N-dimethyl-5-(6-methylheptan-2-ylamino)-1,2-thiazole-4-sulfonamide has a molecular weight of 334.51 g/mol, XLogP of 2.60, 8 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-N,N-dimethyl-5-(6-methylheptan-2-ylamino)-1,2-thiazole-4-sulfonamide is sourced from PubChem (CID 103359978), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).