C9H15F3N4O2S2 — CID 103364947
3-amino-N,N-dimethyl-5-(4,4,4-trifluorobutylamino)-1,2-thiazole-4-sulfonamide (PubChem CID 103364947) has the molecular formula C9H15F3N4O2S2 and a molecular weight of 332.37 g/mol. Its IUPAC name is 3-amino-N,N-dimethyl-5-(4,4,4-trifluorobutylamino)-1,2-thiazole-4-sulfonamide.
| Compound Name | 3-amino-N,N-dimethyl-5-(4,4,4-trifluorobutylamino)-1,2-thiazole-4-sulfonamide |
|---|---|
| PubChem CID | 103364947 |
| Molecular Formula | C9H15F3N4O2S2 |
| Molecular Weight | 332.37 g/mol |
| Exact Mass | 332.06 |
| IUPAC Name | 3-amino-N,N-dimethyl-5-(4,4,4-trifluorobutylamino)-1,2-thiazole-4-sulfonamide |
| SMILES | CN(C)S(=O)(=O)c1c(N)nsc1NCCCC(F)(F)F |
| InChI | InChI=1S/C9H15F3N4O2S2/c1-16(2)20(17,18)6-7(13)15-19-8(6)14-5-3-4-9(10,11)12/h14H,3-5H2,1-2H3,(H2,13,15) |
| InChIKey | FMRGEWSYGSMXSC-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 88.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.37 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|