C7H13N3O2S3 — CID 103381226
5-N-(2-methylsulfanylethyl)-4-methylsulfonyl-1,2-thiazole-3,5-diamine (PubChem CID 103381226) has the molecular formula C7H13N3O2S3 and a molecular weight of 267.40 g/mol. Its IUPAC name is 5-N-(2-methylsulfanylethyl)-4-methylsulfonyl-1,2-thiazole-3,5-diamine.
| Compound Name | 5-N-(2-methylsulfanylethyl)-4-methylsulfonyl-1,2-thiazole-3,5-diamine |
|---|---|
| PubChem CID | 103381226 |
| Molecular Formula | C7H13N3O2S3 |
| Molecular Weight | 267.40 g/mol |
| Exact Mass | 267.02 |
| IUPAC Name | 5-N-(2-methylsulfanylethyl)-4-methylsulfonyl-1,2-thiazole-3,5-diamine |
| SMILES | CSCCNc1snc(N)c1S(C)(=O)=O |
| InChI | InChI=1S/C7H13N3O2S3/c1-13-4-3-9-7-5(15(2,11)12)6(8)10-14-7/h9H,3-4H2,1-2H3,(H2,8,10) |
| InChIKey | QPKMZYJHFFNRHL-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.40 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|