C9H16N4O2S — CID 106239169
2-[2-[(3-propyl-1,2,4-thiadiazol-5-yl)amino]ethoxy]acetamide (PubChem CID 106239169) has the molecular formula C9H16N4O2S and a molecular weight of 244.32 g/mol. Its IUPAC name is 2-[2-[(3-propyl-1,2,4-thiadiazol-5-yl)amino]ethoxy]acetamide.
| Compound Name | 2-[2-[(3-propyl-1,2,4-thiadiazol-5-yl)amino]ethoxy]acetamide |
|---|---|
| PubChem CID | 106239169 |
| Molecular Formula | C9H16N4O2S |
| Molecular Weight | 244.32 g/mol |
| Exact Mass | 244.10 |
| IUPAC Name | 2-[2-[(3-propyl-1,2,4-thiadiazol-5-yl)amino]ethoxy]acetamide |
| SMILES | CCCc1nsc(NCCOCC(N)=O)n1 |
| InChI | InChI=1S/C9H16N4O2S/c1-2-3-8-12-9(16-13-8)11-4-5-15-6-7(10)14/h2-6H2,1H3,(H2,10,14)(H,11,12,13) |
| InChIKey | PZIYGQHWRJGPCB-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 90.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.32 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|