About 2-methyl-2-[(3-propyl-1,2,4-thiadiazol-5-yl)amino]propanamide
2-methyl-2-[(3-propyl-1,2,4-thiadiazol-5-yl)amino]propanamide (PubChem CID 65277150) has the molecular formula C9H16N4OS
and a molecular weight of 228.32 g/mol. Its IUPAC name is 2-methyl-2-[(3-propyl-1,2,4-thiadiazol-5-yl)amino]propanamide.
Molecular Properties
| Compound Name | 2-methyl-2-[(3-propyl-1,2,4-thiadiazol-5-yl)amino]propanamide |
| PubChem CID | 65277150 |
| Molecular Formula | C9H16N4OS |
| Molecular Weight | 228.32 g/mol |
| Exact Mass | 228.10 |
| IUPAC Name | 2-methyl-2-[(3-propyl-1,2,4-thiadiazol-5-yl)amino]propanamide |
| SMILES | CCCc1nsc(NC(C)(C)C(N)=O)n1 |
| InChI | InChI=1S/C9H16N4OS/c1-4-5-6-11-8(15-13-6)12-9(2,3)7(10)14/h4-5H2,1-3H3,(H2,10,14)(H,11,12,13) |
| InChIKey | IGQBXJNWTGJLAO-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.32 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-methyl-2-[(3-propyl-1,2,4-thiadiazol-5-yl)amino]propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-2-[(3-propyl-1,2,4-thiadiazol-5-yl)amino]propanamide?
The IUPAC name of 2-methyl-2-[(3-propyl-1,2,4-thiadiazol-5-yl)amino]propanamide (CID 65277150) is 2-methyl-2-[(3-propyl-1,2,4-thiadiazol-5-yl)amino]propanamide.
What is the SMILES notation for 2-methyl-2-[(3-propyl-1,2,4-thiadiazol-5-yl)amino]propanamide?
The canonical SMILES for 2-methyl-2-[(3-propyl-1,2,4-thiadiazol-5-yl)amino]propanamide is CCCc1nsc(NC(C)(C)C(N)=O)n1.
What is the InChIKey of 2-methyl-2-[(3-propyl-1,2,4-thiadiazol-5-yl)amino]propanamide?
The InChIKey is IGQBXJNWTGJLAO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16N4OS/c1-4-5-6-11-8(15-13-6)12-9(2,3)7(10)14/h4-5H2,1-3H3,(H2,10,14)(H,11,12,13).
What are the key properties of 2-methyl-2-[(3-propyl-1,2,4-thiadiazol-5-yl)amino]propanamide?
2-methyl-2-[(3-propyl-1,2,4-thiadiazol-5-yl)amino]propanamide has a molecular weight of 228.32 g/mol, XLogP of 1.17, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-2-[(3-propyl-1,2,4-thiadiazol-5-yl)amino]propanamide is sourced from PubChem (CID 65277150), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).