C14H17N3O2S — CID 65273614
4-[2-[(3-propyl-1,2,4-thiadiazol-5-yl)amino]ethyl]benzoic acid (PubChem CID 65273614) has the molecular formula C14H17N3O2S and a molecular weight of 291.38 g/mol. Its IUPAC name is 4-[2-[(3-propyl-1,2,4-thiadiazol-5-yl)amino]ethyl]benzoic acid.
| Compound Name | 4-[2-[(3-propyl-1,2,4-thiadiazol-5-yl)amino]ethyl]benzoic acid |
|---|---|
| PubChem CID | 65273614 |
| Molecular Formula | C14H17N3O2S |
| Molecular Weight | 291.38 g/mol |
| Exact Mass | 291.10 |
| IUPAC Name | 4-[2-[(3-propyl-1,2,4-thiadiazol-5-yl)amino]ethyl]benzoic acid |
| SMILES | CCCc1nsc(NCCc2ccc(C(=O)O)cc2)n1 |
| InChI | InChI=1S/C14H17N3O2S/c1-2-3-12-16-14(20-17-12)15-9-8-10-4-6-11(7-5-10)13(18)19/h4-7H,2-3,8-9H2,1H3,(H,18,19)(H,15,16,17) |
| InChIKey | FJFAAGVENSAFTL-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.38 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |