C9H16N4OS — CID 65271676
N-[2-[(3-propyl-1,2,4-thiadiazol-5-yl)amino]ethyl]acetamide (PubChem CID 65271676) has the molecular formula C9H16N4OS and a molecular weight of 228.32 g/mol. Its IUPAC name is N-[2-[(3-propyl-1,2,4-thiadiazol-5-yl)amino]ethyl]acetamide.
| Compound Name | N-[2-[(3-propyl-1,2,4-thiadiazol-5-yl)amino]ethyl]acetamide |
|---|---|
| PubChem CID | 65271676 |
| Molecular Formula | C9H16N4OS |
| Molecular Weight | 228.32 g/mol |
| Exact Mass | 228.10 |
| IUPAC Name | N-[2-[(3-propyl-1,2,4-thiadiazol-5-yl)amino]ethyl]acetamide |
| SMILES | CCCc1nsc(NCCNC(C)=O)n1 |
| InChI | InChI=1S/C9H16N4OS/c1-3-4-8-12-9(15-13-8)11-6-5-10-7(2)14/h3-6H2,1-2H3,(H,10,14)(H,11,12,13) |
| InChIKey | RFEIJCLBTMUQLT-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.32 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|