About 3-methyl-3-[(3-propyl-1,2,4-thiadiazol-5-yl)amino]pentan-1-ol
3-methyl-3-[(3-propyl-1,2,4-thiadiazol-5-yl)amino]pentan-1-ol (PubChem CID 106171537) has the molecular formula C11H21N3OS
and a molecular weight of 243.38 g/mol. Its IUPAC name is 3-methyl-3-[(3-propyl-1,2,4-thiadiazol-5-yl)amino]pentan-1-ol.
Molecular Properties
| Compound Name | 3-methyl-3-[(3-propyl-1,2,4-thiadiazol-5-yl)amino]pentan-1-ol |
| PubChem CID | 106171537 |
| Molecular Formula | C11H21N3OS |
| Molecular Weight | 243.38 g/mol |
| Exact Mass | 243.14 |
| IUPAC Name | 3-methyl-3-[(3-propyl-1,2,4-thiadiazol-5-yl)amino]pentan-1-ol |
| SMILES | CCCc1nsc(NC(C)(CC)CCO)n1 |
| InChI | InChI=1S/C11H21N3OS/c1-4-6-9-12-10(16-14-9)13-11(3,5-2)7-8-15/h15H,4-8H2,1-3H3,(H,12,13,14) |
| InChIKey | MCADYUHXGXBGMJ-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.38 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-methyl-3-[(3-propyl-1,2,4-thiadiazol-5-yl)amino]pentan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-3-[(3-propyl-1,2,4-thiadiazol-5-yl)amino]pentan-1-ol?
The IUPAC name of 3-methyl-3-[(3-propyl-1,2,4-thiadiazol-5-yl)amino]pentan-1-ol (CID 106171537) is 3-methyl-3-[(3-propyl-1,2,4-thiadiazol-5-yl)amino]pentan-1-ol.
What is the SMILES notation for 3-methyl-3-[(3-propyl-1,2,4-thiadiazol-5-yl)amino]pentan-1-ol?
The canonical SMILES for 3-methyl-3-[(3-propyl-1,2,4-thiadiazol-5-yl)amino]pentan-1-ol is CCCc1nsc(NC(C)(CC)CCO)n1.
What is the InChIKey of 3-methyl-3-[(3-propyl-1,2,4-thiadiazol-5-yl)amino]pentan-1-ol?
The InChIKey is MCADYUHXGXBGMJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21N3OS/c1-4-6-9-12-10(16-14-9)13-11(3,5-2)7-8-15/h15H,4-8H2,1-3H3,(H,12,13,14).
What are the key properties of 3-methyl-3-[(3-propyl-1,2,4-thiadiazol-5-yl)amino]pentan-1-ol?
3-methyl-3-[(3-propyl-1,2,4-thiadiazol-5-yl)amino]pentan-1-ol has a molecular weight of 243.38 g/mol, XLogP of 2.45, 7 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-3-[(3-propyl-1,2,4-thiadiazol-5-yl)amino]pentan-1-ol is sourced from PubChem (CID 106171537), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).