C6H11N5O2S — CID 106241467
2-[2-[(3-amino-1,2,4-thiadiazol-5-yl)amino]ethoxy]acetamide (PubChem CID 106241467) has the molecular formula C6H11N5O2S and a molecular weight of 217.25 g/mol. Its IUPAC name is 2-[2-[(3-amino-1,2,4-thiadiazol-5-yl)amino]ethoxy]acetamide.
| Compound Name | 2-[2-[(3-amino-1,2,4-thiadiazol-5-yl)amino]ethoxy]acetamide |
|---|---|
| PubChem CID | 106241467 |
| Molecular Formula | C6H11N5O2S |
| Molecular Weight | 217.25 g/mol |
| Exact Mass | 217.06 |
| IUPAC Name | 2-[2-[(3-amino-1,2,4-thiadiazol-5-yl)amino]ethoxy]acetamide |
| SMILES | NC(=O)COCCNc1nc(N)ns1 |
| InChI | InChI=1S/C6H11N5O2S/c7-4(12)3-13-2-1-9-6-10-5(8)11-14-6/h1-3H2,(H2,7,12)(H3,8,9,10,11) |
| InChIKey | MIWWACLZSHAHJT-UHFFFAOYSA-N |
| XLogP | -0.97 |
| TPSA | 116.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.25 |
| LogP ≤ 5 | -0.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|