C12H15N3O2S — CID 106240152
2-[2-[(5-methyl-1,3-benzothiazol-2-yl)amino]ethoxy]acetamide (PubChem CID 106240152) has the molecular formula C12H15N3O2S and a molecular weight of 265.34 g/mol. Its IUPAC name is 2-[2-[(5-methyl-1,3-benzothiazol-2-yl)amino]ethoxy]acetamide.
| Compound Name | 2-[2-[(5-methyl-1,3-benzothiazol-2-yl)amino]ethoxy]acetamide |
|---|---|
| PubChem CID | 106240152 |
| Molecular Formula | C12H15N3O2S |
| Molecular Weight | 265.34 g/mol |
| Exact Mass | 265.09 |
| IUPAC Name | 2-[2-[(5-methyl-1,3-benzothiazol-2-yl)amino]ethoxy]acetamide |
| SMILES | Cc1ccc2sc(NCCOCC(N)=O)nc2c1 |
| InChI | InChI=1S/C12H15N3O2S/c1-8-2-3-10-9(6-8)15-12(18-10)14-4-5-17-7-11(13)16/h2-3,6H,4-5,7H2,1H3,(H2,13,16)(H,14,15) |
| InChIKey | XGGHEKXEZGFELU-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.34 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|