C7H12ClN3OS — CID 43808242
4-chloro-N-(3-ethoxypropyl)-1,2,5-thiadiazol-3-amine (PubChem CID 43808242) has the molecular formula C7H12ClN3OS and a molecular weight of 221.71 g/mol. Its IUPAC name is 4-chloro-N-(3-ethoxypropyl)-1,2,5-thiadiazol-3-amine.
| Compound Name | 4-chloro-N-(3-ethoxypropyl)-1,2,5-thiadiazol-3-amine |
|---|---|
| PubChem CID | 43808242 |
| Molecular Formula | C7H12ClN3OS |
| Molecular Weight | 221.71 g/mol |
| Exact Mass | 221.04 |
| IUPAC Name | 4-chloro-N-(3-ethoxypropyl)-1,2,5-thiadiazol-3-amine |
| SMILES | CCOCCCNc1nsnc1Cl |
| InChI | InChI=1S/C7H12ClN3OS/c1-2-12-5-3-4-9-7-6(8)10-13-11-7/h2-5H2,1H3,(H,9,11) |
| InChIKey | KEEPRHPFYMXPHR-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.71 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|