C10H15ClN2O — CID 53410274
6-chloro-N-(3-ethoxypropyl)pyridin-2-amine (PubChem CID 53410274) has the molecular formula C10H15ClN2O and a molecular weight of 214.70 g/mol. Its IUPAC name is 6-chloro-N-(3-ethoxypropyl)pyridin-2-amine.
| Compound Name | 6-chloro-N-(3-ethoxypropyl)pyridin-2-amine |
|---|---|
| PubChem CID | 53410274 |
| Molecular Formula | C10H15ClN2O |
| Molecular Weight | 214.70 g/mol |
| Exact Mass | 214.09 |
| IUPAC Name | 6-chloro-N-(3-ethoxypropyl)pyridin-2-amine |
| SMILES | CCOCCCNc1cccc(Cl)n1 |
| InChI | InChI=1S/C10H15ClN2O/c1-2-14-8-4-7-12-10-6-3-5-9(11)13-10/h3,5-6H,2,4,7-8H2,1H3,(H,12,13) |
| InChIKey | QBKSAWLGRWGXOQ-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.70 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|