C11H18N2O2 — CID 63590219
6-ethoxy-N-(3-methoxypropyl)pyridin-2-amine (PubChem CID 63590219) has the molecular formula C11H18N2O2 and a molecular weight of 210.28 g/mol. Its IUPAC name is 6-ethoxy-N-(3-methoxypropyl)pyridin-2-amine.
| Compound Name | 6-ethoxy-N-(3-methoxypropyl)pyridin-2-amine |
|---|---|
| PubChem CID | 63590219 |
| Molecular Formula | C11H18N2O2 |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.14 |
| IUPAC Name | 6-ethoxy-N-(3-methoxypropyl)pyridin-2-amine |
| SMILES | CCOc1cccc(NCCCOC)n1 |
| InChI | InChI=1S/C11H18N2O2/c1-3-15-11-7-4-6-10(13-11)12-8-5-9-14-2/h4,6-7H,3,5,8-9H2,1-2H3,(H,12,13) |
| InChIKey | WGTBKPJWRIQEPZ-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|