C9H15N3O — CID 80647839
6-N-(3-methoxypropyl)pyridine-2,6-diamine (PubChem CID 80647839) has the molecular formula C9H15N3O and a molecular weight of 181.24 g/mol. Its IUPAC name is 6-N-(3-methoxypropyl)pyridine-2,6-diamine.
| Compound Name | 6-N-(3-methoxypropyl)pyridine-2,6-diamine |
|---|---|
| PubChem CID | 80647839 |
| Molecular Formula | C9H15N3O |
| Molecular Weight | 181.24 g/mol |
| Exact Mass | 181.12 |
| IUPAC Name | 6-N-(3-methoxypropyl)pyridine-2,6-diamine |
| SMILES | COCCCNc1cccc(N)n1 |
| InChI | InChI=1S/C9H15N3O/c1-13-7-3-6-11-9-5-2-4-8(10)12-9/h2,4-5H,3,6-7H2,1H3,(H3,10,11,12) |
| InChIKey | JSRLZSPRNFILFC-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.24 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|