C14H23ClN2 — CID 107817529
6-chloro-N-(7-methyloctyl)pyridin-2-amine (PubChem CID 107817529) has the molecular formula C14H23ClN2 and a molecular weight of 254.80 g/mol. Its IUPAC name is 6-chloro-N-(7-methyloctyl)pyridin-2-amine.
| Compound Name | 6-chloro-N-(7-methyloctyl)pyridin-2-amine |
|---|---|
| PubChem CID | 107817529 |
| Molecular Formula | C14H23ClN2 |
| Molecular Weight | 254.80 g/mol |
| Exact Mass | 254.15 |
| IUPAC Name | 6-chloro-N-(7-methyloctyl)pyridin-2-amine |
| SMILES | CC(C)CCCCCCNc1cccc(Cl)n1 |
| InChI | InChI=1S/C14H23ClN2/c1-12(2)8-5-3-4-6-11-16-14-10-7-9-13(15)17-14/h7,9-10,12H,3-6,8,11H2,1-2H3,(H,16,17) |
| InChIKey | MFIIAFBQGFWXIA-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.80 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|