C7H10Cl2N4O2S — CID 79632714
3-[(2,5-dichloropyrimidin-4-yl)amino]propane-1-sulfonamide (PubChem CID 79632714) has the molecular formula C7H10Cl2N4O2S and a molecular weight of 285.16 g/mol. Its IUPAC name is 3-[(2,5-dichloropyrimidin-4-yl)amino]propane-1-sulfonamide.
| Compound Name | 3-[(2,5-dichloropyrimidin-4-yl)amino]propane-1-sulfonamide |
|---|---|
| PubChem CID | 79632714 |
| Molecular Formula | C7H10Cl2N4O2S |
| Molecular Weight | 285.16 g/mol |
| Exact Mass | 283.99 |
| IUPAC Name | 3-[(2,5-dichloropyrimidin-4-yl)amino]propane-1-sulfonamide |
| SMILES | NS(=O)(=O)CCCNc1nc(Cl)ncc1Cl |
| InChI | InChI=1S/C7H10Cl2N4O2S/c8-5-4-12-7(9)13-6(5)11-2-1-3-16(10,14)15/h4H,1-3H2,(H2,10,14,15)(H,11,12,13) |
| InChIKey | TULYLTGZFSPODQ-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 97.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.16 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|