C10H14Cl2N4O — CID 79632812
3-[(2,5-dichloropyrimidin-4-yl)amino]-N-propylpropanamide (PubChem CID 79632812) has the molecular formula C10H14Cl2N4O and a molecular weight of 277.15 g/mol. Its IUPAC name is 3-[(2,5-dichloropyrimidin-4-yl)amino]-N-propylpropanamide.
| Compound Name | 3-[(2,5-dichloropyrimidin-4-yl)amino]-N-propylpropanamide |
|---|---|
| PubChem CID | 79632812 |
| Molecular Formula | C10H14Cl2N4O |
| Molecular Weight | 277.15 g/mol |
| Exact Mass | 276.05 |
| IUPAC Name | 3-[(2,5-dichloropyrimidin-4-yl)amino]-N-propylpropanamide |
| SMILES | CCCNC(=O)CCNc1nc(Cl)ncc1Cl |
| InChI | InChI=1S/C10H14Cl2N4O/c1-2-4-13-8(17)3-5-14-9-7(11)6-15-10(12)16-9/h6H,2-5H2,1H3,(H,13,17)(H,14,15,16) |
| InChIKey | UNRYNVJESPMXLE-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.15 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |