C19H20Cl2FN7O — CID 90033783
2-[4-[[4-[(2,6-dichloro-3-fluorophenyl)methylamino]pyrimidin-2-yl]amino]pyrazol-1-yl]-3-methylbutanamide (PubChem CID 90033783) has the molecular formula C19H20Cl2FN7O and a molecular weight of 452.32 g/mol. Its IUPAC name is 2-[4-[[4-[(2,6-dichloro-3-fluorophenyl)methylamino]pyrimidin-2-yl]amino]pyrazol-1-yl]-3-methylbutanamide.
| Compound Name | 2-[4-[[4-[(2,6-dichloro-3-fluorophenyl)methylamino]pyrimidin-2-yl]amino]pyrazol-1-yl]-3-methylbutanamide |
|---|---|
| PubChem CID | 90033783 |
| Molecular Formula | C19H20Cl2FN7O |
| Molecular Weight | 452.32 g/mol |
| Exact Mass | 451.11 |
| IUPAC Name | 2-[4-[[4-[(2,6-dichloro-3-fluorophenyl)methylamino]pyrimidin-2-yl]amino]pyrazol-1-yl]-3-methylbutanamide |
| SMILES | CC(C)C(C(N)=O)n1cc(Nc2nccc(NCc3c(Cl)ccc(F)c3Cl)n2)cn1 |
| InChI | InChI=1S/C19H20Cl2FN7O/c1-10(2)17(18(23)30)29-9-11(7-26-29)27-19-24-6-5-15(28-19)25-8-12-13(20)3-4-14(22)16(12)21/h3-7,9-10,17H,8H2,1-2H3,(H2,23,30)(H2,24,25,27,28) |
| InChIKey | YDRIYYBHJAQUKI-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 110.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.32 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|