C12H11ClFN3O2 — CID 19624725
4-[(2-chloro-6-fluorophenyl)methylamino]-1-methylpyrazole-5-carboxylic acid (PubChem CID 19624725) has the molecular formula C12H11ClFN3O2 and a molecular weight of 283.69 g/mol. Its IUPAC name is 4-[(2-chloro-6-fluorophenyl)methylamino]-1-methylpyrazole-5-carboxylic acid.
| Compound Name | 4-[(2-chloro-6-fluorophenyl)methylamino]-1-methylpyrazole-5-carboxylic acid |
|---|---|
| PubChem CID | 19624725 |
| Molecular Formula | C12H11ClFN3O2 |
| Molecular Weight | 283.69 g/mol |
| Exact Mass | 283.05 |
| IUPAC Name | 4-[(2-chloro-6-fluorophenyl)methylamino]-1-methylpyrazole-5-carboxylic acid |
| SMILES | Cn1ncc(NCc2c(F)cccc2Cl)c1C(=O)O |
| InChI | InChI=1S/C12H11ClFN3O2/c1-17-11(12(18)19)10(6-16-17)15-5-7-8(13)3-2-4-9(7)14/h2-4,6,15H,5H2,1H3,(H,18,19) |
| InChIKey | TVWKYQXYVVPAQQ-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.69 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |