C15H17FN5OS+ — CID 7248404
[5-(2-fluorophenyl)furan-2-yl]methyl-[2-(1-methyltetrazol-5-yl)sulfanylethyl]azanium (PubChem CID 7248404) has the molecular formula C15H17FN5OS+ and a molecular weight of 334.40 g/mol. Its IUPAC name is [5-(2-fluorophenyl)furan-2-yl]methyl-[2-(1-methyltetrazol-5-yl)sulfanylethyl]azanium.
| Compound Name | [5-(2-fluorophenyl)furan-2-yl]methyl-[2-(1-methyltetrazol-5-yl)sulfanylethyl]azanium |
|---|---|
| PubChem CID | 7248404 |
| Molecular Formula | C15H17FN5OS+ |
| Molecular Weight | 334.40 g/mol |
| Exact Mass | 334.11 |
| IUPAC Name | [5-(2-fluorophenyl)furan-2-yl]methyl-[2-(1-methyltetrazol-5-yl)sulfanylethyl]azanium |
| SMILES | Cn1nnnc1SCC[NH2+]Cc1ccc(-c2ccccc2F)o1 |
| InChI | InChI=1S/C15H16FN5OS/c1-21-15(18-19-20-21)23-9-8-17-10-11-6-7-14(22-11)12-4-2-3-5-13(12)16/h2-7,17H,8-10H2,1H3/p+1 |
| InChIKey | LFEMCCMJEUIACN-UHFFFAOYSA-O |
| XLogP | 1.46 |
| TPSA | 73.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.40 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|