C13H20N5OS+ — CID 7449437
(4-ethoxyphenyl)methyl-[2-(1-methyltetrazol-5-yl)sulfanylethyl]azanium (PubChem CID 7449437) has the molecular formula C13H20N5OS+ and a molecular weight of 294.40 g/mol. Its IUPAC name is (4-ethoxyphenyl)methyl-[2-(1-methyltetrazol-5-yl)sulfanylethyl]azanium.
| Compound Name | (4-ethoxyphenyl)methyl-[2-(1-methyltetrazol-5-yl)sulfanylethyl]azanium |
|---|---|
| PubChem CID | 7449437 |
| Molecular Formula | C13H20N5OS+ |
| Molecular Weight | 294.40 g/mol |
| Exact Mass | 294.14 |
| IUPAC Name | (4-ethoxyphenyl)methyl-[2-(1-methyltetrazol-5-yl)sulfanylethyl]azanium |
| SMILES | CCOc1ccc(C[NH2+]CCSc2nnnn2C)cc1 |
| InChI | InChI=1S/C13H19N5OS/c1-3-19-12-6-4-11(5-7-12)10-14-8-9-20-13-15-16-17-18(13)2/h4-7,14H,3,8-10H2,1-2H3/p+1 |
| InChIKey | DBQGWDJJVSDFBU-UHFFFAOYSA-O |
| XLogP | 0.46 |
| TPSA | 69.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.40 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|