C12H17BrClN5OS — CID 44664242
(5-bromo-2-methoxyphenyl)methyl-[2-(1-methyltetrazol-5-yl)sulfanylethyl]azanium chloride (PubChem CID 44664242) has the molecular formula C12H17BrClN5OS and a molecular weight of 394.73 g/mol. Its IUPAC name is (5-bromo-2-methoxyphenyl)methyl-[2-(1-methyltetrazol-5-yl)sulfanylethyl]azanium chloride.
| Compound Name | (5-bromo-2-methoxyphenyl)methyl-[2-(1-methyltetrazol-5-yl)sulfanylethyl]azanium chloride |
|---|---|
| PubChem CID | 44664242 |
| Molecular Formula | C12H17BrClN5OS |
| Molecular Weight | 394.73 g/mol |
| Exact Mass | 393.00 |
| IUPAC Name | (5-bromo-2-methoxyphenyl)methyl-[2-(1-methyltetrazol-5-yl)sulfanylethyl]azanium chloride |
| SMILES | COc1ccc(Br)cc1C[NH2+]CCSc1nnnn1C.[Cl-] |
| InChI | InChI=1S/C12H16BrN5OS.ClH/c1-18-12(15-16-17-18)20-6-5-14-8-9-7-10(13)3-4-11(9)19-2;/h3-4,7,14H,5-6,8H2,1-2H3;1H |
| InChIKey | NRBQHHKWZQNYEH-UHFFFAOYSA-N |
| XLogP | -2.16 |
| TPSA | 69.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.73 |
| LogP ≤ 5 | -2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|