C10H15N6S+ — CID 7005222
2-(1-methyltetrazol-5-yl)sulfanylethyl-(pyridin-4-ylmethyl)azanium (PubChem CID 7005222) has the molecular formula C10H15N6S+ and a molecular weight of 251.34 g/mol. Its IUPAC name is 2-(1-methyltetrazol-5-yl)sulfanylethyl-(pyridin-4-ylmethyl)azanium.
| Compound Name | 2-(1-methyltetrazol-5-yl)sulfanylethyl-(pyridin-4-ylmethyl)azanium |
|---|---|
| PubChem CID | 7005222 |
| Molecular Formula | C10H15N6S+ |
| Molecular Weight | 251.34 g/mol |
| Exact Mass | 251.11 |
| IUPAC Name | 2-(1-methyltetrazol-5-yl)sulfanylethyl-(pyridin-4-ylmethyl)azanium |
| SMILES | Cn1nnnc1SCC[NH2+]Cc1ccncc1 |
| InChI | InChI=1S/C10H14N6S/c1-16-10(13-14-15-16)17-7-6-12-8-9-2-4-11-5-3-9/h2-5,12H,6-8H2,1H3/p+1 |
| InChIKey | HRUOSIRSXXCCBE-UHFFFAOYSA-O |
| XLogP | -0.54 |
| TPSA | 73.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.34 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|