C13H18N5O2S+ — CID 7450464
2,3-dihydro-1,4-benzodioxin-6-ylmethyl-[2-(1-methyltetrazol-5-yl)sulfanylethyl]azanium (PubChem CID 7450464) has the molecular formula C13H18N5O2S+ and a molecular weight of 308.39 g/mol. Its IUPAC name is 2,3-dihydro-1,4-benzodioxin-6-ylmethyl-[2-(1-methyltetrazol-5-yl)sulfanylethyl]azanium.
| Compound Name | 2,3-dihydro-1,4-benzodioxin-6-ylmethyl-[2-(1-methyltetrazol-5-yl)sulfanylethyl]azanium |
|---|---|
| PubChem CID | 7450464 |
| Molecular Formula | C13H18N5O2S+ |
| Molecular Weight | 308.39 g/mol |
| Exact Mass | 308.12 |
| IUPAC Name | 2,3-dihydro-1,4-benzodioxin-6-ylmethyl-[2-(1-methyltetrazol-5-yl)sulfanylethyl]azanium |
| SMILES | Cn1nnnc1SCC[NH2+]Cc1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C13H17N5O2S/c1-18-13(15-16-17-18)21-7-4-14-9-10-2-3-11-12(8-10)20-6-5-19-11/h2-3,8,14H,4-7,9H2,1H3/p+1 |
| InChIKey | RVWHSNPIEGOUBI-UHFFFAOYSA-O |
| XLogP | -0.16 |
| TPSA | 78.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.39 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|