C12H16Cl2N5S+ — CID 8639757
(2,6-dichlorophenyl)methyl-[3-(1-methyltetrazol-5-yl)sulfanylpropyl]azanium (PubChem CID 8639757) has the molecular formula C12H16Cl2N5S+ and a molecular weight of 333.27 g/mol. Its IUPAC name is (2,6-dichlorophenyl)methyl-[3-(1-methyltetrazol-5-yl)sulfanylpropyl]azanium.
| Compound Name | (2,6-dichlorophenyl)methyl-[3-(1-methyltetrazol-5-yl)sulfanylpropyl]azanium |
|---|---|
| PubChem CID | 8639757 |
| Molecular Formula | C12H16Cl2N5S+ |
| Molecular Weight | 333.27 g/mol |
| Exact Mass | 332.05 |
| IUPAC Name | (2,6-dichlorophenyl)methyl-[3-(1-methyltetrazol-5-yl)sulfanylpropyl]azanium |
| SMILES | Cn1nnnc1SCCC[NH2+]Cc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C12H15Cl2N5S/c1-19-12(16-17-18-19)20-7-3-6-15-8-9-10(13)4-2-5-11(9)14/h2,4-5,15H,3,6-8H2,1H3/p+1 |
| InChIKey | WLWCXGFLWHJBJI-UHFFFAOYSA-O |
| XLogP | 1.76 |
| TPSA | 60.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.27 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|