C16H19FN5OS+ — CID 7447687
[5-(2-fluorophenyl)furan-2-yl]methyl-[3-(1-methyltetrazol-5-yl)sulfanylpropyl]azanium (PubChem CID 7447687) has the molecular formula C16H19FN5OS+ and a molecular weight of 348.43 g/mol. Its IUPAC name is [5-(2-fluorophenyl)furan-2-yl]methyl-[3-(1-methyltetrazol-5-yl)sulfanylpropyl]azanium.
| Compound Name | [5-(2-fluorophenyl)furan-2-yl]methyl-[3-(1-methyltetrazol-5-yl)sulfanylpropyl]azanium |
|---|---|
| PubChem CID | 7447687 |
| Molecular Formula | C16H19FN5OS+ |
| Molecular Weight | 348.43 g/mol |
| Exact Mass | 348.13 |
| IUPAC Name | [5-(2-fluorophenyl)furan-2-yl]methyl-[3-(1-methyltetrazol-5-yl)sulfanylpropyl]azanium |
| SMILES | Cn1nnnc1SCCC[NH2+]Cc1ccc(-c2ccccc2F)o1 |
| InChI | InChI=1S/C16H18FN5OS/c1-22-16(19-20-21-22)24-10-4-9-18-11-12-7-8-15(23-12)13-5-2-3-6-14(13)17/h2-3,5-8,18H,4,9-11H2,1H3/p+1 |
| InChIKey | IGUZRILRCCJUGZ-UHFFFAOYSA-O |
| XLogP | 1.86 |
| TPSA | 73.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.43 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|