C17H20BrN5OS — CID 17056498
N-[[5-(4-bromo-2-methylphenyl)furan-2-yl]methyl]-3-(1-methyltetrazol-5-yl)sulfanylpropan-1-amine (PubChem CID 17056498) has the molecular formula C17H20BrN5OS and a molecular weight of 422.35 g/mol. Its IUPAC name is N-[[5-(4-bromo-2-methylphenyl)furan-2-yl]methyl]-3-(1-methyltetrazol-5-yl)sulfanylpropan-1-amine.
| Compound Name | N-[[5-(4-bromo-2-methylphenyl)furan-2-yl]methyl]-3-(1-methyltetrazol-5-yl)sulfanylpropan-1-amine |
|---|---|
| PubChem CID | 17056498 |
| Molecular Formula | C17H20BrN5OS |
| Molecular Weight | 422.35 g/mol |
| Exact Mass | 421.06 |
| IUPAC Name | N-[[5-(4-bromo-2-methylphenyl)furan-2-yl]methyl]-3-(1-methyltetrazol-5-yl)sulfanylpropan-1-amine |
| SMILES | Cc1cc(Br)ccc1-c1ccc(CNCCCSc2nnnn2C)o1 |
| InChI | InChI=1S/C17H20BrN5OS/c1-12-10-13(18)4-6-15(12)16-7-5-14(24-16)11-19-8-3-9-25-17-20-21-22-23(17)2/h4-7,10,19H,3,8-9,11H2,1-2H3 |
| InChIKey | ATCZGTFFEGPYHV-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 68.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.35 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|