C21H20BrN5OS — CID 17123316
N-[[5-(4-bromophenyl)furan-2-yl]methyl]-3-(1-phenyltetrazol-5-yl)sulfanylpropan-1-amine (PubChem CID 17123316) has the molecular formula C21H20BrN5OS and a molecular weight of 470.40 g/mol. Its IUPAC name is N-[[5-(4-bromophenyl)furan-2-yl]methyl]-3-(1-phenyltetrazol-5-yl)sulfanylpropan-1-amine.
| Compound Name | N-[[5-(4-bromophenyl)furan-2-yl]methyl]-3-(1-phenyltetrazol-5-yl)sulfanylpropan-1-amine |
|---|---|
| PubChem CID | 17123316 |
| Molecular Formula | C21H20BrN5OS |
| Molecular Weight | 470.40 g/mol |
| Exact Mass | 469.06 |
| IUPAC Name | N-[[5-(4-bromophenyl)furan-2-yl]methyl]-3-(1-phenyltetrazol-5-yl)sulfanylpropan-1-amine |
| SMILES | Brc1ccc(-c2ccc(CNCCCSc3nnnn3-c3ccccc3)o2)cc1 |
| InChI | InChI=1S/C21H20BrN5OS/c22-17-9-7-16(8-10-17)20-12-11-19(28-20)15-23-13-4-14-29-21-24-25-26-27(21)18-5-2-1-3-6-18/h1-3,5-12,23H,4,13-15H2 |
| InChIKey | GUONVHVGXBZHGQ-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 68.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.40 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|