C23H24ClN5O3S — CID 17333417
methyl 4-[5-[[3-(1-phenyltetrazol-5-yl)sulfanylpropylamino]methyl]furan-2-yl]benzoate;hydrochloride (PubChem CID 17333417) has the molecular formula C23H24ClN5O3S and a molecular weight of 486.00 g/mol. Its IUPAC name is methyl 4-[5-[[3-(1-phenyltetrazol-5-yl)sulfanylpropylamino]methyl]furan-2-yl]benzoate;hydrochloride.
| Compound Name | methyl 4-[5-[[3-(1-phenyltetrazol-5-yl)sulfanylpropylamino]methyl]furan-2-yl]benzoate;hydrochloride |
|---|---|
| PubChem CID | 17333417 |
| Molecular Formula | C23H24ClN5O3S |
| Molecular Weight | 486.00 g/mol |
| Exact Mass | 485.13 |
| IUPAC Name | methyl 4-[5-[[3-(1-phenyltetrazol-5-yl)sulfanylpropylamino]methyl]furan-2-yl]benzoate;hydrochloride |
| SMILES | COC(=O)c1ccc(-c2ccc(CNCCCSc3nnnn3-c3ccccc3)o2)cc1.Cl |
| InChI | InChI=1S/C23H23N5O3S.ClH/c1-30-22(29)18-10-8-17(9-11-18)21-13-12-20(31-21)16-24-14-5-15-32-23-25-26-27-28(23)19-6-3-2-4-7-19;/h2-4,6-13,24H,5,14-16H2,1H3;1H |
| InChIKey | FMQGPXHUTPKJEM-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 95.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.00 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|