C20H17Br2N5OS — CID 17213098
N-[[5-(2,4-dibromophenyl)furan-2-yl]methyl]-2-(1-phenyltetrazol-5-yl)sulfanylethanamine (PubChem CID 17213098) has the molecular formula C20H17Br2N5OS and a molecular weight of 535.27 g/mol. Its IUPAC name is N-[[5-(2,4-dibromophenyl)furan-2-yl]methyl]-2-(1-phenyltetrazol-5-yl)sulfanylethanamine.
| Compound Name | N-[[5-(2,4-dibromophenyl)furan-2-yl]methyl]-2-(1-phenyltetrazol-5-yl)sulfanylethanamine |
|---|---|
| PubChem CID | 17213098 |
| Molecular Formula | C20H17Br2N5OS |
| Molecular Weight | 535.27 g/mol |
| Exact Mass | 532.95 |
| IUPAC Name | N-[[5-(2,4-dibromophenyl)furan-2-yl]methyl]-2-(1-phenyltetrazol-5-yl)sulfanylethanamine |
| SMILES | Brc1ccc(-c2ccc(CNCCSc3nnnn3-c3ccccc3)o2)c(Br)c1 |
| InChI | InChI=1S/C20H17Br2N5OS/c21-14-6-8-17(18(22)12-14)19-9-7-16(28-19)13-23-10-11-29-20-24-25-26-27(20)15-4-2-1-3-5-15/h1-9,12,23H,10-11,13H2 |
| InChIKey | DEIDFNUZPUCIHU-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 68.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.27 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|