C22H23N5O2S — CID 8639555
(1S)-1-[4-[5-[[2-(1-phenyltetrazol-5-yl)sulfanylethylamino]methyl]furan-2-yl]phenyl]ethanol (PubChem CID 8639555) has the molecular formula C22H23N5O2S and a molecular weight of 421.53 g/mol. Its IUPAC name is (1S)-1-[4-[5-[[2-(1-phenyltetrazol-5-yl)sulfanylethylamino]methyl]furan-2-yl]phenyl]ethanol.
| Compound Name | (1S)-1-[4-[5-[[2-(1-phenyltetrazol-5-yl)sulfanylethylamino]methyl]furan-2-yl]phenyl]ethanol |
|---|---|
| PubChem CID | 8639555 |
| Molecular Formula | C22H23N5O2S |
| Molecular Weight | 421.53 g/mol |
| Exact Mass | 421.16 |
| IUPAC Name | (1S)-1-[4-[5-[[2-(1-phenyltetrazol-5-yl)sulfanylethylamino]methyl]furan-2-yl]phenyl]ethanol |
| SMILES | C[C@H](O)c1ccc(-c2ccc(CNCCSc3nnnn3-c3ccccc3)o2)cc1 |
| InChI | InChI=1S/C22H23N5O2S/c1-16(28)17-7-9-18(10-8-17)21-12-11-20(29-21)15-23-13-14-30-22-24-25-26-27(22)19-5-3-2-4-6-19/h2-12,16,23,28H,13-15H2,1H3/t16-/m0/s1 |
| InChIKey | BSYWTMGXAUWCMW-INIZCTEOSA-N |
| XLogP | 3.86 |
| TPSA | 89.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.53 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|